CAS 87947-57-7

Thiophene, tetrahydro-3-(pentylsulfinyl)-, 1,1-dioxide

Description:

Thiophene, tetrahydro-3-(pentylsulfinyl)-, 1,1-dioxide, with the CAS number 87947-57-7, is a sulfur-containing heterocyclic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing one sulfur atom. The compound features a tetrahydro configuration, indicating that it has undergone hydrogenation, resulting in a saturated form of the thiophene. The presence of a pentylsulfinyl group introduces a sulfinyl functional group, which can influence the compound's reactivity and solubility. The 1,1-dioxide designation indicates that there are two oxygen atoms bonded to the sulfur atom in the thiophene ring, contributing to its stability and potentially affecting its electronic properties. This compound may exhibit interesting chemical behavior due to the interplay between its aromatic and saturated characteristics, making it of interest in various fields, including organic synthesis and materials science. Its specific applications and reactivity would depend on the context of its use and the presence of other functional groups in related compounds.

Formula: C₉H₁₈O₃S₂

InChI: InChI=1S/C9H18O3S2/c1-2-3-4-6-13(10)9-5-7-14(11,12)8-9/h9H,2-8H2,1H3

InChI key: BFASPVRRKHNNNP-UHFFFAOYSA-N

SMILES: CCCCCS(=O)C1CCS(=O)(=O)C1