CAS 87947-58-8

Thiophene, 3-(hexylsulfinyl)tetrahydro-, 1,1-dioxide

Description:

Thiophene, 3-(hexylsulfinyl)tetrahydro-, 1,1-dioxide, identified by CAS number 87947-58-8, is a sulfur-containing heterocyclic compound characterized by a five-membered ring structure that includes a thiophene moiety. This compound features a hexylsulfinyl group, which contributes to its unique chemical properties, including potential solubility in organic solvents and reactivity due to the presence of the sulfinyl functional group. The 1,1-dioxide designation indicates the presence of two oxygen atoms bonded to the sulfur atom in the thiophene ring, enhancing its oxidative stability and influencing its electronic properties. Thiophene derivatives are known for their applications in organic electronics, pharmaceuticals, and as intermediates in chemical synthesis. The presence of the hexyl chain may also impart hydrophobic characteristics, affecting its interactions in biological systems and materials. Overall, this compound's structure suggests potential utility in various chemical applications, although specific reactivity and stability would depend on the surrounding conditions and substituents.

Formula: C₁₀H₂₀O₃S₂

InChI: InChI=1S/C10H20O3S2/c1-2-3-4-5-7-14(11)10-6-8-15(12,13)9-10/h10H,2-9H2,1H3

InChI key: UQHBSVHKVXXNTK-UHFFFAOYSA-N

SMILES: CCCCCCS(=O)C1CCS(=O)(=O)C1