CAS 87947-62-4

Thiophene, 2,5-dihydro-3-[(octylsulfinyl)methyl]-, 1,1-dioxide

Description:

Thiophene, 2,5-dihydro-3-[(octylsulfinyl)methyl]-, 1,1-dioxide, identified by CAS number 87947-62-4, is a sulfur-containing heterocyclic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing one sulfur atom. This compound features a dihydro substitution at the 2 and 5 positions, indicating the presence of additional hydrogen atoms that contribute to its saturation. The presence of an octylsulfinyl group at the 3 position introduces a long hydrophobic alkyl chain, enhancing its solubility in organic solvents and potentially influencing its biological activity. The 1,1-dioxide functional group suggests the presence of two double-bonded oxygen atoms, which can affect the compound's reactivity and stability. Overall, this compound may exhibit interesting properties such as potential applications in organic synthesis, materials science, or pharmaceuticals, owing to its unique structural features and functional groups. However, specific applications and biological activities would require further investigation and characterization.

Formula: C₁₃H₂₄O₃S₂

InChI: InChI=1S/C13H24O3S2/c1-2-3-4-5-6-7-9-17(14)11-13-8-10-18(15,16)12-13/h8H,2-7,9-12H2,1H3

InChI key: GHBNJUPSZCXSKH-UHFFFAOYSA-N

SMILES: CCCCCCCCS(=O)CC1=CCS(=O)(=O)C1