CAS 87948-64-9
:N-(6-methylpyridin-2-yl)-7-oxo-1-phenyl-1,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide
Description:
N-(6-methylpyridin-2-yl)-7-oxo-1-phenyl-1,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxamide, with the CAS number 87948-64-9, is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of a phenyl group and a methylpyridine moiety suggests that it may exhibit interesting electronic and steric properties, which could influence its reactivity and interactions with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-inflammatory, analgesic, or anticancer activities. The specific arrangement of heteroatoms and functional groups in this molecule may also affect its solubility, stability, and overall bioavailability. As with many heterocyclic compounds, the synthesis and characterization of this substance are crucial for understanding its potential applications in medicinal chemistry and drug development.
Formula:C19H15N5O2
InChI:InChI=1/C19H15N5O2/c1-13-6-5-9-16(21-13)22-18(25)15-12-20-17-10-11-23(24(17)19(15)26)14-7-3-2-4-8-14/h2-12H,1H3,(H,21,22,25)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(6-METHYL-PYRIDIN-2-YL)-7-OXO-1-PHENYL-1,7-DIHYDROPYRAZOLO[1,5-A]PYRIMIDINE-6-CARBOXAMIDE
CAS:Formula:C19H15N5O2Molecular weight:345.3547
