CAS 879487-88-4
:4-Iodo-1-[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethyl]-1H-pyrazole
Description:
4-Iodo-1-[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethyl]-1H-pyrazole is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a tetrahydro-2H-pyran moiety. The presence of the iodine atom introduces notable properties, such as increased molecular weight and potential for enhanced reactivity in various chemical reactions. The tetrahydro-2H-pyran group contributes to the compound's solubility and stability, making it suitable for various applications in medicinal chemistry and organic synthesis. This compound may exhibit biological activity due to its structural features, which can interact with biological targets. Its synthesis typically involves multi-step organic reactions, and it may be used as an intermediate in the development of pharmaceuticals or agrochemicals. As with many halogenated compounds, safety considerations regarding its handling and disposal are essential, given the potential for toxicity associated with iodine-containing substances. Overall, 4-Iodo-1-[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethyl]-1H-pyrazole represents a valuable compound in the field of chemical research.
Formula:C10H15IN2O2
InChI:InChI=1S/C10H15IN2O2/c11-9-7-12-13(8-9)4-6-15-10-3-1-2-5-14-10/h7-8,10H,1-6H2
InChI key:InChIKey=HVRQFISDBJZTGY-UHFFFAOYSA-N
SMILES:C(COC1CCCCO1)N2C=C(I)C=N2
Synonyms:- 4-Iodo-1-[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethyl]-1H-pyrazole
- 1H-Pyrazole, 4-iodo-1-[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.