CAS 87951-99-3

8-Oxa-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid, (R)-

Description:

8-Oxa-1-thia-4-azaspiro[4.5]decane-3-carboxylic acid, (R)-, is a chemical compound characterized by its unique spirocyclic structure, which includes a combination of oxygen, sulfur, and nitrogen atoms within its framework. The presence of the carboxylic acid functional group contributes to its acidity and potential reactivity in various chemical reactions. This compound is notable for its stereochemistry, specifically the (R)- configuration, which indicates the spatial arrangement of its atoms and can influence its biological activity and interactions. The spirocyclic nature of the molecule may impart distinctive properties, such as rigidity and specific conformational characteristics, which can affect its solubility and interaction with biological targets. Additionally, the presence of heteroatoms (oxygen, sulfur, and nitrogen) can enhance its potential as a pharmacophore in medicinal chemistry, making it a candidate for further investigation in drug development. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with spiro structures.

Formula: C₈H₁₃NO₃S

InChI: InChI=1S/C8H13NO3S/c10-7(11)6-5-13-8(9-6)1-3-12-4-2-8/h6,9H,1-5H2,(H,10,11)/t6-/m0/s1

InChI key: JBSSRIXLYROGNF-LURJTMIESA-N

SMILES: C1COCCC12N[C@@H](CS2)C(=O)O