CAS 87953-84-2

4H-1-Benzopyran-4-one, 6-chloro-5,8-dihydroxy-2-phenyl-

Description:

4H-1-Benzopyran-4-one, 6-chloro-5,8-dihydroxy-2-phenyl- is a chemical compound that belongs to the class of flavonoids, which are known for their diverse biological activities. This compound features a benzopyran core structure, characterized by a fused benzene and pyran ring, which is typical of many flavonoids. The presence of hydroxyl groups at the 5 and 8 positions contributes to its potential antioxidant properties, while the chloro substituent at the 6 position may influence its reactivity and biological interactions. The phenyl group at the 2 position enhances its structural complexity and may affect its solubility and interaction with biological targets. Compounds of this nature are often studied for their pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. Additionally, the specific arrangement of functional groups can significantly impact the compound's stability, solubility, and overall bioactivity, making it a subject of interest in medicinal chemistry and natural product research.

Formula: C₁₅H₉ClO₄

InChI: InChI=1S/C15H9ClO4/c16-9-6-11(18)15-13(14(9)19)10(17)7-12(20-15)8-4-2-1-3-5-8/h1-7,18-19H

InChI key: MOZCOPYKKCSAFD-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=CC(=C3O)Cl)O