CAS 87954-38-9

Cyclohexene, 1,3,4-trimethyl-, trans-

Description:

Cyclohexene, 1,3,4-trimethyl-, trans- is an organic compound characterized by its cyclic structure and unsaturation due to the presence of a double bond in the cyclohexene ring. This compound features three methyl groups attached to the cyclohexene ring at the 1, 3, and 4 positions, contributing to its unique chemical properties and steric effects. The "trans" designation indicates that the substituents across the double bond are oriented in opposite directions, which influences the compound's stability and reactivity. Typically, cyclohexene derivatives exhibit properties such as low to moderate boiling points and moderate solubility in organic solvents. The presence of multiple methyl groups can enhance the hydrophobic character of the molecule, making it less soluble in polar solvents. Cyclohexene derivatives are often used in organic synthesis and can serve as intermediates in the production of various chemicals, including pharmaceuticals and agrochemicals. As with many unsaturated hydrocarbons, they may also participate in addition reactions, making them versatile in synthetic organic chemistry.

Formula: C₉H₁₆

InChI: InChI=1S/C9H16/c1-7-4-5-8(2)9(3)6-7/h6,8-9H,4-5H2,1-3H3/t8-,9-/m1/s1

InChI key: WPWQRKXPPCURBJ-RKDXNWHRSA-N

SMILES: C[C@@H]1CCC(=C[C@H]1C)C