CymitQuimica logo

CAS 879542-48-0

:

methyl 3-chloro-5-formylbenzoate

Description:
Methyl 3-chloro-5-formylbenzoate is an organic compound characterized by its functional groups and structural features. It belongs to the class of benzoates, which are esters derived from benzoic acid. The presence of a chloro group at the 3-position and a formyl group at the 5-position on the benzene ring contributes to its reactivity and potential applications in organic synthesis. The methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. This compound may exhibit properties such as moderate volatility and potential reactivity with nucleophiles due to the electrophilic nature of the formyl group. Additionally, the chlorinated aromatic structure may impart unique electronic properties, influencing its behavior in chemical reactions. Methyl 3-chloro-5-formylbenzoate can be utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals, due to its functional versatility. As with many organic compounds, safety precautions should be observed when handling this substance, considering potential toxicity and environmental impact.
Formula:C9H7ClO3
InChI:InChI=1S/C9H7ClO3/c1-13-9(12)7-2-6(5-11)3-8(10)4-7/h2-5H,1H3
InChI key:JUCIYUKIAAFMJA-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=CC(=C1)C=O)Cl
Found 5 products.