CAS 879547-33-8

Pyrazinecarboxamide, 5-(1,1-dimethylethyl)-N-(5-methyl-2-thiazolyl)-

Description:

Pyrazinecarboxamide, 5-(1,1-dimethylethyl)-N-(5-methyl-2-thiazolyl)-, identified by CAS number 879547-33-8, is a chemical compound that features a pyrazine ring substituted with a carboxamide group and a thiazole moiety. This compound is characterized by its heterocyclic structure, which includes nitrogen and sulfur atoms, contributing to its potential biological activity. The presence of the bulky 1,1-dimethylethyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Pyrazine derivatives are often studied for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The thiazole ring, known for its role in various bioactive compounds, may also contribute to the overall reactivity and interaction with biological targets. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and drug development, although specific biological activities and mechanisms would require further investigation through experimental studies.

Formula: C₁₃H₁₆N₄OS

InChI: InChI=1S/C13H16N4OS/c1-8-5-16-12(19-8)17-11(18)9-6-15-10(7-14-9)13(2,3)4/h5-7H,1-4H3,(H,16,17,18)

InChI key: GYMVTWROAIJYDD-UHFFFAOYSA-N

SMILES: CC1=CN=C(S1)NC(=O)C2=CN=C(C=N2)C(C)(C)C