CAS 879547-35-0

Pyrazinecarboxamide, N-(2-bromophenyl)-6-chloro-

Description:

Pyrazinecarboxamide, N-(2-bromophenyl)-6-chloro- is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of the carboxamide functional group indicates that it has an amide linkage, contributing to its potential as a bioactive molecule. The compound features a 2-bromophenyl substituent, which introduces a bromine atom on the phenyl ring, potentially influencing its reactivity and biological activity. Additionally, the presence of a chlorine atom at the 6-position of the pyrazine ring adds to its halogenated nature, which can enhance lipophilicity and affect its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and behavior would depend on further studies, including its solubility, stability, and interaction with biological systems. As with many halogenated compounds, considerations regarding environmental impact and safety are also important.

Formula: C₁₁H₇BrClN₃O

InChI: InChI=1S/C11H7BrClN3O/c12-7-3-1-2-4-8(7)16-11(17)9-5-14-6-10(13)15-9/h1-6H,(H,16,17)

InChI key: RZKVGMZISJAARZ-UHFFFAOYSA-N

SMILES: C1=CC=C(C(=C1)NC(=O)C2=CN=CC(=N2)Cl)Br