CAS 87956-09-0
:1,1'-[benzene-1,4-diylbis(2-methyl-1H-pyrrole-4,3-diyl)]diethanone
Description:
1,1'-[Benzene-1,4-diylbis(2-methyl-1H-pyrrole-4,3-diyl)]diethanone, with the CAS number 87956-09-0, is an organic compound characterized by its complex structure, which includes a benzene ring and two pyrrole units connected by diethanone linkages. This compound exhibits properties typical of both aromatic and heterocyclic compounds, contributing to its potential applications in organic electronics, dyes, and pharmaceuticals. The presence of the pyrrole moieties suggests that it may exhibit interesting electronic properties, such as conductivity or photoluminescence, making it a candidate for research in materials science. Additionally, the diethanone groups may impart reactivity that can be exploited in further chemical synthesis or functionalization. Its solubility, stability, and reactivity would depend on the specific conditions, such as solvent and temperature, under which it is studied. Overall, this compound represents a fascinating intersection of aromatic and heterocyclic chemistry, with potential implications in various fields of research and application.
Formula:C20H20N2O2
InChI:InChI=1/C20H20N2O2/c1-11-19(13(3)23)17(9-21-11)15-5-7-16(8-6-15)18-10-22-12(2)20(18)14(4)24/h5-10,21-22H,1-4H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[4-[4-(4-acetyl-5-methyl-1H-pyrrol-3-yl)phenyl]-2-methyl-1H-pyrrol-3-yl]ethanone
CAS:Formula:C20H20N2O2Molecular weight:320.385
