CAS 87956-84-1

N-[3-Methoxy-4-(methylthio)phenyl]ethanethioamide

Description:

N-[3-Methoxy-4-(methylthio)phenyl]ethanethioamide, with the CAS number 87956-84-1, is an organic compound characterized by its unique structure that includes a methoxy group, a methylthio group, and an ethanethioamide functional group. This compound typically exhibits properties associated with thioamides, such as potential reactivity in nucleophilic substitution reactions due to the presence of the thioamide functional group. The methoxy and methylthio substituents can influence its solubility, polarity, and overall reactivity, making it of interest in various chemical applications, including medicinal chemistry and agrochemicals. The presence of the aromatic ring contributes to its stability and may affect its interaction with biological targets. Additionally, the compound may exhibit specific biological activities, which can be explored in pharmacological studies. Overall, N-[3-Methoxy-4-(methylthio)phenyl]ethanethioamide represents a complex structure that combines elements of both aromatic and aliphatic chemistry, making it a subject of interest for further research and application.

Formula: C₁₀H₁₃NOS₂

InChI: InChI=1S/C10H13NOS2/c1-7(13)11-8-4-5-10(14-3)9(6-8)12-2/h4-6H,1-3H3,(H,11,13)

InChI key: InChIKey=BVTITDLRACYMAW-UHFFFAOYSA-N

SMILES: S(C)C1=C(OC)C=C(NC(C)=S)C=C1

Synonyms:

• Ethanethioamide, N-[3-methoxy-4-(methylthio)phenyl]-
• N-[3-Methoxy-4-(methylthio)phenyl]ethanethioamide

Ethanethioamide, N-[3-methoxy-4-(methylthio)phenyl]-

CAS: 87956-84-1

Formula: C₁₀H₁₃NOS₂

Molecular weight: 227.3463

Ref: IN-DA004E91