CAS 879560-20-0

Benzene, 1-methyl-4-(8-phenyl-1,3,5,7-octatetraynyl)-

Description:

Benzene, 1-methyl-4-(8-phenyl-1,3,5,7-octatetraynyl)-, also known by its CAS number 879560-20-0, is an organic compound characterized by its complex structure that includes a benzene ring substituted with a methyl group and a long carbon chain featuring multiple alkyne groups. This compound exhibits properties typical of aromatic compounds, such as stability and resonance, due to the delocalized electrons in the benzene ring. The presence of the octatetraynyl chain, which consists of alternating single and triple bonds, contributes to its unique reactivity and potential applications in materials science and organic electronics. The phenyl group attached to the alkyne chain can enhance the compound's electronic properties, making it of interest in the development of organic semiconductors. Additionally, the compound's structure suggests potential for interesting interactions in various chemical environments, including those relevant to photonic and electronic applications. However, detailed studies on its physical and chemical properties, such as solubility, melting point, and reactivity, would be necessary to fully understand its behavior in different contexts.

Formula: C₂₁H₁₂

InChI: InChI=1S/C21H12/c1-19-15-17-21(18-16-19)14-8-5-3-2-4-7-11-20-12-9-6-10-13-20/h6,9-10,12-13,15-18H,1H3

InChI key: QVZSMIVQMHQXQV-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)C#CC#CC#CC#CC2=CC=CC=C2