CAS 87958-15-4

1,2-Diazabicyclo[5.2.0]nona-3,5-dien-9-one, 8-azido-2-benzoyl-, cis-

Description:

1,2-Diazabicyclo[5.2.0]nona-3,5-dien-9-one, 8-azido-2-benzoyl-, cis- (CAS 87958-15-4) is a complex organic compound characterized by its bicyclic structure, which includes a diazabicyclo framework and an azido functional group. The presence of the azido group (-N3) indicates potential for reactivity, particularly in click chemistry applications, while the benzoyl moiety contributes to its stability and solubility in organic solvents. This compound is likely to exhibit interesting photochemical properties due to the conjugated diene system, which can participate in various chemical reactions, including cycloadditions and rearrangements. Its stereochemistry, indicated by the "cis-" designation, suggests specific spatial arrangements that may influence its reactivity and interactions with other molecules. Overall, this compound could be of interest in synthetic organic chemistry, particularly in the development of new materials or pharmaceuticals, owing to its unique structural features and functional groups.

Formula: C₁₄H₁₁N₅O₂

InChI: InChI=1S/C14H11N5O2/c15-17-16-12-11-8-4-5-9-18(19(11)14(12)21)13(20)10-6-2-1-3-7-10/h1-9,11-12H/t11-,12-/m1/s1

InChI key: LUKQVLDQKGBXBS-VXGBXAGGSA-N

SMILES: C1=CC=C(C=C1)C(=O)N2C=CC=C[C@H]3N2C(=O)[C@@H]3N=[N+]=[N-]