CAS 879590-14-4

2-methoxy-5-[1,3]oxazolo[4,5-b]pyridin-2-ylaniline

Description:

2-Methoxy-5-[1,3]oxazolo[4,5-b]pyridin-2-ylaniline is a chemical compound characterized by its complex structure, which includes a methoxy group, an oxazole ring, and a pyridine moiety. This compound features an aniline group, which contributes to its potential as a building block in organic synthesis and medicinal chemistry. The presence of the oxazole ring suggests that it may exhibit interesting biological activities, possibly related to its ability to interact with various biological targets. The methoxy group can influence the compound's solubility and reactivity, making it a versatile candidate for further chemical modifications. Additionally, the unique arrangement of heteroatoms in the structure may impart specific electronic properties, affecting its reactivity and interaction with other molecules. Overall, 2-methoxy-5-[1,3]oxazolo[4,5-b]pyridin-2-ylaniline represents a class of compounds that may have applications in pharmaceuticals, agrochemicals, or materials science, warranting further investigation into its properties and potential uses.

Formula: C₁₃H₁₁N₃O₂

InChI: InChI=1/C13H11N3O2/c1-17-10-5-4-8(7-9(10)14)13-16-12-11(18-13)3-2-6-15-12/h2-7H,14H2,1H3

SMILES: COc1ccc(cc1N)c1nc2c(cccn2)o1

Synonyms:

• Benzenamine, 2-Methoxy-5-Oxazolo[4,5-B]Pyridin-2-Yl-

(2-methoxy-5-[1,3]oxazolo[4,5-b]pyridin-2-ylphenyl)amine

CAS: 879590-14-4

Formula: C₁₃H₁₁N₃O₂

Molecular weight: 241.2453

Ref: IN-DA004E8X

(2-methoxy-5-[1,3]oxazolo[4,5-b]pyridin-2-ylphenyl)amine

CAS: 879590-14-4

Purity: 95.0%

Molecular weight: 241.25

Ref: 10-F315838