CAS 87961-41-9

5-(1,3-benzodioxol-5-yl)-5-oxopentanoic acid

Description:

5-(1,3-benzodioxol-5-yl)-5-oxopentanoic acid, with the CAS number 87961-41-9, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and a pentanoic acid backbone. This compound features a five-membered carbon chain with a ketone functional group and a carboxylic acid group, which contributes to its acidic properties. The presence of the benzodioxole ring enhances its potential for biological activity, making it of interest in medicinal chemistry and pharmacology. The compound is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a candidate for further research in synthetic and medicinal chemistry. Overall, 5-(1,3-benzodioxol-5-yl)-5-oxopentanoic acid represents a versatile structure with potential implications in various chemical and biological fields.

Formula: C₁₂H₁₂O₅

InChI: InChI=1/C12H12O5/c13-9(2-1-3-12(14)15)8-4-5-10-11(6-8)17-7-16-10/h4-6H,1-3,7H2,(H,14,15)

SMILES: C(CC(=O)c1ccc2c(c1)OCO2)CC(=O)O

Synonyms:

• 1,3-Benzodioxole-5-pentanoic acid, delta-oxo-
• 5-(1,3-Benzodioxol-5-yl)-5-oxopentanoic acid

5-[3,4-(Methylenedioxy)phenyl]-5-oxovaleric acid

CAS: 87961-41-9

Formula: C₁₂H₁₂O₅

Purity: 95.0%

Molecular weight: 236.223

Ref: 10-F022954