CAS 879619-76-8
:N-benzyl-N-(2-phenylethyl)piperidin-4-amine
Description:
N-benzyl-N-(2-phenylethyl)piperidin-4-amine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a benzyl group and a 2-phenylethyl substituent, contributing to its structural complexity and potential biological activity. It is typically classified as an amine due to the presence of the amine functional group attached to the piperidine ring. The presence of multiple aromatic rings suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with neurotransmitter systems. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C20H26N2
InChI:InChI=1/C20H26N2/c1-3-7-18(8-4-1)13-16-22(20-11-14-21-15-12-20)17-19-9-5-2-6-10-19/h1-10,20-21H,11-17H2
SMILES:c1ccc(cc1)CCN(Cc1ccccc1)C1CCNCC1
Synonyms:- N-benzyl-N-(2-phenylethyl)piperidin-4-amine(SALTDATA: HCl)
- N-benzyl-N-(2-phenylethyl)-4-piperidinamine
- N-benzyl-N-phenethylpiperidin-4-amine
- N-BENZYL-N-(2-PHENYLETHYL)PIPERIDIN-4-AMINE
- CHEMBRDG-BB 6766468
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
