CAS 87963-44-8

2,5-Cyclohexadien-1-one, 4-amino-3,5-dichloro-4-hydroxy-

Description:

2,5-Cyclohexadien-1-one, 4-amino-3,5-dichloro-4-hydroxy- is an organic compound characterized by its unique bicyclic structure, which includes a cyclohexadiene ring and various functional groups. The presence of amino, dichloro, and hydroxy groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is likely to exhibit properties such as moderate solubility in polar solvents due to the hydroxyl group, while the chlorinated substituents may influence its electronic properties and reactivity. The dichloro substituents can enhance its biological activity, making it of interest in pharmaceutical research. Additionally, the compound may display specific UV-Vis absorption characteristics due to its conjugated system, which can be useful for analytical purposes. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a versatile structure with potential applications in various chemical and biological fields.

Formula: C₆H₅Cl₂NO₂

InChI: InChI=1S/C6H5Cl2NO2/c7-4-1-3(10)2-5(8)6(4,9)11/h1-2,11H,9H2

InChI key: AAYJGOOJWKWNPK-UHFFFAOYSA-N

SMILES: C1=C(C(C(=CC1=O)Cl)(N)O)Cl