CAS 87964-65-6

Dibenzofuran, 2,8-bis[(phenylmethyl)sulfonyl]-

Description:

Dibenzofuran, 2,8-bis[(phenylmethyl)sulfonyl]- is an organic compound characterized by its complex structure, which includes a dibenzofuran core substituted with two phenylmethylsulfonyl groups. This compound is typically a solid at room temperature and may exhibit properties such as low solubility in water but higher solubility in organic solvents. Its sulfonyl groups contribute to its reactivity, making it useful in various chemical reactions, including those involving nucleophiles. The presence of the dibenzofuran moiety suggests potential applications in organic synthesis and materials science, particularly in the development of functional materials or pharmaceuticals. Additionally, the compound may exhibit interesting electronic properties due to its conjugated system, which can influence its behavior in photochemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound represents a unique combination of structural features that may lend itself to diverse applications in chemistry and related fields.

Formula: C₂₆H₂₀O₅S₂

InChI: InChI=1S/C26H20O5S2/c27-32(28,17-19-7-3-1-4-8-19)21-11-13-25-23(15-21)24-16-22(12-14-26(24)31-25)33(29,30)18-20-9-5-2-6-10-20/h1-16H,17-18H2

InChI key: RNXJOGJMEOEKKN-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)CS(=O)(=O)C2=CC3=C(C=C2)OC4=C3C=C(C=C4)S(=O)(=O)CC5=CC=CC=C5