CAS 879643-87-5
:2-(azepan-1-yl)-2-(4-methoxyphenyl)ethanamine
Description:
2-(Azepan-1-yl)-2-(4-methoxyphenyl)ethanamine, identified by its CAS number 879643-87-5, is a chemical compound that features a unique structure combining an azepane ring and a methoxy-substituted phenyl group. This compound is classified as an amine due to the presence of an amino group, which contributes to its basicity and potential reactivity. The azepane moiety, a seven-membered saturated nitrogen-containing ring, imparts specific steric and electronic properties that can influence the compound's biological activity. The 4-methoxyphenyl group enhances lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Such structural characteristics suggest that this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would be of interest for applications in drug development or neuropharmacology.
Formula:C15H24N2O
InChI:InChI=1/C15H24N2O/c1-18-14-8-6-13(7-9-14)15(12-16)17-10-4-2-3-5-11-17/h6-9,15H,2-5,10-12,16H2,1H3
SMILES:COc1ccc(cc1)C(CN)N1CCCCCC1
Synonyms:- 1H-azepine-1-ethanamine, hexahydro-β-(4-methoxyphenyl)-
- 879643-87-5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.