CAS 879668-17-4
:4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine hydrochloride
Description:
4,5,6,7-Tetrahydro-1H-pyrazolo[3,4-c]pyridine hydrochloride is a chemical compound characterized by its bicyclic structure, which includes a pyrazole ring fused to a pyridine ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for various applications in medicinal chemistry and drug development. The hydrochloride salt form enhances its stability and solubility, which is advantageous for pharmaceutical formulations. The compound may exhibit biological activity, potentially acting as a modulator of certain receptors or enzymes, although specific pharmacological properties would depend on further research. Its molecular structure contributes to its reactivity and interaction with biological systems, making it a subject of interest in the development of therapeutic agents. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols due to potential toxicity or reactivity.
Formula:C6H10ClN3
InChI:InChI=1/C6H9N3.ClH/c1-2-7-4-6-5(1)3-8-9-6;/h3,7H,1-2,4H2,(H,8,9);1H
SMILES:C1CNCc2c1c[nH]n2.Cl
Synonyms:- 4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridinehydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,5,6,7-Tetrahydro-5-azabenzimidazole hydrochloride, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6H10ClN3Purity:95%Molecular weight:159.624,5,6,7-Tetrahydro-3h-imidazo[4,5-c]pyridine, HCl
CAS:Formula:C6H10ClN3Purity:98%Color and Shape:SolidMolecular weight:159.61674,5,6,7-Tetrahydro-3H-Imidazo[4,5-C]Pyridine Hydrochloride
CAS:4,5,6,7-Tetrahydro-3H-Imidazo[4,5-C]Pyridine HydrochloridePurity:98%Molecular weight:159.62g/mol4,5,6,7-Tetrahydro-3H-imidazo[4,5-c]pyridine hydrochloride
CAS:Formula:C6H10ClN3Purity:95%Color and Shape:SolidMolecular weight:159.62



