CAS 87967-18-8

Acetic acid, [(4-chlorophenyl)amino]oxo-, 2-propenyl ester

Description:

Acetic acid, [(4-chlorophenyl)amino]oxo-, 2-propenyl ester, with the CAS number 87967-18-8, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and a specific amine. This compound features a 4-chlorophenyl group, indicating the presence of a chlorine substituent on the phenyl ring, which can influence its reactivity and physical properties. The presence of the propenyl group suggests that it may participate in various chemical reactions, including polymerization or addition reactions, due to the unsaturation in the propenyl moiety. Typically, esters like this one are known for their distinctive odors and are often used in flavoring and fragrance applications. Additionally, the presence of the amino group may impart biological activity, making it of interest in pharmaceutical research. The compound's solubility, boiling point, and other physical properties would depend on its molecular structure and the interactions between its functional groups.

Formula: C₁₁H₁₀ClNO₃

InChI: InChI=1S/C11H10ClNO3/c1-2-7-16-11(15)10(14)13-9-5-3-8(12)4-6-9/h2-6H,1,7H2,(H,13,14)

InChI key: SZASGQHPBHTWRF-UHFFFAOYSA-N

SMILES: C=CCOC(=O)C(=O)NC1=CC=C(C=C1)Cl