CAS 87967-25-7

Acetic acid, [(4-bromo-3-chlorophenyl)amino]oxo-, 2-propenyl ester

Description:

Acetic acid, [(4-bromo-3-chlorophenyl)amino]oxo-, 2-propenyl ester, identified by CAS number 87967-25-7, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and an amine. This compound features a complex structure that includes a 4-bromo-3-chlorophenyl group, contributing to its potential biological activity and reactivity. The presence of halogen substituents (bromine and chlorine) on the aromatic ring can influence the compound's physical and chemical properties, such as solubility and reactivity. As an ester, it may exhibit typical ester characteristics, including volatility and a tendency to undergo hydrolysis in the presence of water. The propenyl group indicates that it may participate in addition reactions, making it a potentially useful intermediate in organic synthesis. Overall, this compound's unique structure suggests it could have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₁₁H₉BrClNO₃

InChI: InChI=1S/C11H9BrClNO3/c1-2-5-17-11(16)10(15)14-7-3-4-8(12)9(13)6-7/h2-4,6H,1,5H2,(H,14,15)

InChI key: NDLLANFZMIAHOV-UHFFFAOYSA-N

SMILES: C=CCOC(=O)C(=O)NC1=CC(=C(C=C1)Br)Cl