CAS 87967-27-9
:[(3-fluorophenyl)amino](oxo)acetic acid
Description:
[(3-Fluorophenyl)amino](oxo)acetic acid, with the CAS number 87967-27-9, is an organic compound characterized by the presence of a fluorinated aromatic ring and an amino acid structure. The compound features a 3-fluorophenyl group, which contributes to its unique chemical properties, including potential reactivity and interaction with biological systems. The amino group (-NH2) is attached to the phenyl ring, while the oxoacetic acid moiety includes a carboxylic acid (-COOH) and a carbonyl group (C=O), indicating its acidic nature. This structure allows for hydrogen bonding and potential interactions with various biological targets, making it of interest in medicinal chemistry. The presence of the fluorine atom can enhance lipophilicity and influence the compound's pharmacokinetics. Overall, [(3-fluorophenyl)amino](oxo)acetic acid exhibits characteristics typical of amino acids and aromatic compounds, which may be relevant in drug design and development.
Formula:C8H6FNO3
InChI:InChI=1/C8H6FNO3/c9-5-2-1-3-6(4-5)10-7(11)8(12)13/h1-4H,(H,10,11)(H,12,13)
SMILES:c1cc(cc(c1)NC(=O)C(=O)O)F
Synonyms:- Acetic Acid, 2-[(3-Fluorophenyl)Amino]-2-Oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
