CAS 87967-31-5

Acetic acid, [(3,4-dibromophenyl)amino]oxo-, methyl ester

Description:

Acetic acid, [(3,4-dibromophenyl)amino]oxo-, methyl ester, with the CAS number 87967-31-5, is an organic compound characterized by its ester functional group and the presence of a dibromophenyl moiety. This compound features a methyl ester derived from acetic acid, which contributes to its solubility in organic solvents. The presence of the 3,4-dibromophenyl group indicates that it has significant halogen substitution, which can influence its reactivity and biological activity. The amino group attached to the aromatic ring suggests potential for hydrogen bonding and interactions with biological targets. This compound may exhibit properties such as antimicrobial or antifungal activity, typical of many halogenated organic compounds. Its structure allows for various applications in chemical synthesis, pharmaceuticals, or agrochemicals. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with brominated compounds. Overall, this compound represents a unique combination of functional groups that can lead to diverse chemical behavior and applications.

Formula: C₉H₇Br₂NO₃

InChI: InChI=1S/C9H7Br2NO3/c1-15-9(14)8(13)12-5-2-3-6(10)7(11)4-5/h2-4H,1H3,(H,12,13)

InChI key: SUCKJIYPRRUDHX-UHFFFAOYSA-N

SMILES: COC(=O)C(=O)NC1=CC(=C(C=C1)Br)Br