CAS 87967-40-6

Cyclohexanecarboxylic acid, 1-[(4-methoxybenzoyl)phenylamino]-

Description:

Cyclohexanecarboxylic acid, 1-[(4-methoxybenzoyl)phenylamino]- is an organic compound characterized by its complex structure, which includes a cyclohexane ring, a carboxylic acid functional group, and an amine moiety linked to a methoxybenzoyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in organic solvents. The presence of the carboxylic acid group suggests acidic behavior, while the methoxy group can influence its electronic properties and reactivity. The compound may also display moderate to high melting and boiling points due to its molecular weight and intermolecular interactions. Its unique structure may impart specific biological activities, making it of interest in pharmaceutical and chemical research. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a fascinating intersection of organic chemistry and potential applications in various fields.

Formula: C₂₁H₂₃NO₄

InChI: InChI=1S/C21H23NO4/c1-26-18-12-10-16(11-13-18)19(23)22(17-8-4-2-5-9-17)21(20(24)25)14-6-3-7-15-21/h2,4-5,8-13H,3,6-7,14-15H2,1H3,(H,24,25)

InChI key: KTHNSOQYOLXWBP-UHFFFAOYSA-N

SMILES: COC1=CC=C(C=C1)C(=O)N(C2=CC=CC=C2)C3(CCCCC3)C(=O)O