CAS 87967-79-1

1H-Pyrazole-4-carboxaldehyde, 3-(2-hydroxyphenyl)-

Description:

1H-Pyrazole-4-carboxaldehyde, 3-(2-hydroxyphenyl)-, with CAS number 87967-79-1, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxaldehyde functional group (-CHO) at the 4-position of the pyrazole ring and a phenolic hydroxyl group (-OH) at the 3-position, specifically on a 2-hydroxyphenyl substituent. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The compound may exhibit properties such as being a potential ligand in coordination chemistry or serving as an intermediate in the synthesis of more complex organic molecules. Its solubility and stability can vary depending on the solvent and conditions used. Additionally, the compound's structure suggests potential biological activity, making it of interest in pharmacological research. However, specific properties such as melting point, boiling point, and spectral data would need to be referenced from experimental sources for precise applications.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1S/C10H8N2O2/c13-6-7-5-11-12-10(7)8-3-1-2-4-9(8)14/h1-6,14H,(H,11,12)

InChI key: KJUMTRXBZBPGGQ-UHFFFAOYSA-N

SMILES: C1=CC=C(C(=C1)C2=C(C=NN2)C=O)O