CAS 879686-81-4
:1-benzyl-4-(2-thienyl)pyrrolidine-3-carboxylic acid
Description:
1-Benzyl-4-(2-thienyl)pyrrolidine-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a benzyl group and a thienyl group. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the thienyl moiety, a five-membered aromatic ring containing sulfur, adds to the compound's aromatic character and may influence its biological activity. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyrrolidine and aromatic groups, which are often associated with bioactive compounds. Additionally, the compound's solubility and stability can be influenced by the functional groups present, making it of interest for various chemical and biological studies. Overall, 1-benzyl-4-(2-thienyl)pyrrolidine-3-carboxylic acid represents a complex organic molecule with potential implications in drug design and synthesis.
Formula:C16H17NO2S
InChI:InChI=1/C16H17NO2S/c18-16(19)14-11-17(9-12-5-2-1-3-6-12)10-13(14)15-7-4-8-20-15/h1-8,13-14H,9-11H2,(H,18,19)
SMILES:c1ccc(cc1)CN1CC(C(C1)C(=O)O)c1cccs1
Synonyms:- 1-Benzyl-4-thiophen-2-yl-pyrrolidine-3-carboxylic acid
- 879686-81-4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Benzyl-4-(thiophen-2-yl)pyrrolidine-3-carboxylic acid
CAS:Formula:C16H17NO2SMolecular weight:287.3767
