CAS 87969-70-8

1-Propanone, 1-(1-anthracenyl)-2-methyl-

Description:

1-Propanone, 1-(1-anthracenyl)-2-methyl-, also known by its CAS number 87969-70-8, is an organic compound characterized by its ketone functional group and an anthracene moiety. This substance features a propanone backbone with a methyl group and an anthracene ring, contributing to its unique structural and electronic properties. It is typically a solid at room temperature and exhibits a relatively high melting point due to the presence of the large aromatic anthracene structure, which enhances its stability and affects its solubility in various solvents. The compound is likely to exhibit fluorescence due to the conjugated system of the anthracene, making it of interest in materials science and organic electronics. Additionally, its chemical reactivity may include typical ketone reactions, such as nucleophilic addition. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₈H₁₆O

InChI: InChI=1S/C18H16O/c1-12(2)18(19)16-9-5-8-15-10-13-6-3-4-7-14(13)11-17(15)16/h3-12H,1-2H3

InChI key: HNWUGXIAZIMXSP-UHFFFAOYSA-N

SMILES: CC(C)C(=O)C1=CC=CC2=CC3=CC=CC=C3C=C21