CAS 87974-50-3

Benzaldehyde, 2-hydroxy-5-nitro-, oxime, (E)-

Description:

Benzaldehyde, 2-hydroxy-5-nitro-, oxime, (E)-, is an organic compound characterized by its functional groups, including a hydroxyl group (-OH), a nitro group (-NO2), and an oxime group (-C=N-OH). This compound features a benzene ring substituted with these groups, which influence its chemical reactivity and properties. The (E)- configuration indicates that the oxime group is positioned in a trans arrangement relative to the hydroxyl group, affecting its stereochemistry and potentially its biological activity. Benzaldehyde derivatives often exhibit aromatic characteristics, contributing to their stability and reactivity in various chemical reactions, such as nucleophilic additions and condensation reactions. The presence of the nitro group can enhance the compound's electrophilicity, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit specific solubility characteristics, typically being soluble in organic solvents while having limited solubility in water. Its unique structure and functional groups make it of interest in fields such as medicinal chemistry and materials science.

Formula: C₇H₆N₂O₄

InChI: InChI=1S/C7H6N2O4/c10-7-2-1-6(9(12)13)3-5(7)4-8-11/h1-4,10-11H/b8-4+

InChI key: InChIKey=DVBKBUGAIYQNOE-XBXARRHUSA-N

SMILES: C(=N/O)\C1=CC(N(=O)=O)=CC=C1O

Synonyms:

• Benzaldehyde, 2-hydroxy-5-nitro-, oxime, (E)-
• (E)-2-Hydroxy-5-nitrobenzaldehydeoxime

2-[(1E)-(Hydroxyimino)methyl]-4-nitrophenol

CAS: 87974-50-3

2-[(1E)-(Hydroxyimino)methyl]-4-nitrophenol is a metal salt that binds to chloride ions. It also binds to copper and is used in the manufacture of copper alloys. 2-[(1E)-(Hydroxyimino)methyl]-4-nitrophenol reacts with hydroxylamine and radiation, forming an oxime (5-nitrosalicylaldehyde). The oxime can then react with 5-nitrosalicylic acid to form a salicylaldoxime, which is a ligand.

Formula: C₇H₆N₂O₄

Purity: Min. 95%

Molecular weight: 182.13 g/mol

Ref: 3D-MDA97450