CAS 87976-26-9
:phthalic-D4 acid
Description:
Phthalic-D4 acid, with the CAS number 87976-26-9, is a deuterated form of phthalic acid, which is a diacid commonly used in the production of plasticizers, resins, and dyes. The "D4" designation indicates that the hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen, which is useful in various analytical applications, particularly in nuclear magnetic resonance (NMR) spectroscopy. Phthalic-D4 acid retains the fundamental characteristics of phthalic acid, including its aromatic structure and the presence of two carboxylic acid functional groups. It is typically a white crystalline solid that is soluble in organic solvents but has limited solubility in water. The introduction of deuterium can alter the physical properties slightly, such as melting and boiling points, compared to its non-deuterated counterpart. This compound is primarily utilized in research settings, particularly in studies involving isotopic labeling and tracing in chemical reactions.
Formula:C8H2D4O4
InChI:InChI=1/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/i1D,2D,3D,4D
SMILES:c1(c(c(c(c(c1[2H])C(=O)O)C(=O)O)[2H])[2H])[2H]
Synonyms:- (2H4)benzene-1,2-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phthalic-3,4,5,6-d4 Acid(non marqué 88-99-3)
CAS:Formula:C6D4(COOH)2Purity:98 atom % DColor and Shape:White SolidMolecular weight:170.05172Phthalic Acid-d4
CAS:Controlled ProductStability Hygroscopic
Applications Labelled Phthalic Acid (P384480). Organic reagent used to synthesize phthalates.
References Duchowicz, P.R., et al.: Bioorg. Med. Chem., 16, 7944 (2008), di Luccio, E., et al.: Biochem., 47, 4039 (2008), Lopez, Z., et al.: App. Microbiol. Biotechnol., 78, 739 (2008), Hong, Y., et al.: Toxicol. Lett., 184, 139 (2009),Formula:C82H4H2O4Color and Shape:White To Off-WhiteMolecular weight:170.16





