CAS 87976-71-4
:Propanoic-1-13C acid, 2-oxo-, sodium salt (1:1)
Description:
Propanoic-1-13C acid, 2-oxo-, sodium salt (1:1), with the CAS number 87976-71-4, is a sodium salt derivative of propanoic acid that contains a stable carbon isotope, carbon-13, at the first carbon position. This compound is characterized by its molecular structure, which includes a propanoic acid backbone with a ketone functional group at the second carbon, contributing to its reactivity and potential applications in various chemical reactions. The presence of the sodium ion indicates that it is a salt, which typically enhances its solubility in water compared to its acid form. This compound is often used in research, particularly in studies involving metabolic pathways and isotopic labeling, as the carbon-13 isotope allows for tracking and analysis in nuclear magnetic resonance (NMR) spectroscopy. Additionally, it may have applications in organic synthesis and as a biochemical reagent. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C3H4O3·Na
InChI:InChI=1S/C3H4O3.Na/c1-2(4)3(5)6;/h1H3,(H,5,6);/i3+1;
InChI key:InChIKey=DAQHMCWYXJEOCG-FJUFCODESA-N
SMILES:C([13C](O)=O)(C)=O.[Na]
Synonyms:- Propanoic-1-13C acid, 2-oxo-, sodium salt
- sodium 2-oxo(1-13C)propanoate
- Sodium pyruvate-1-13C
- Pyruvic-1-13C acid sodium salt
- Propanoic-1-13C acid, 2-oxo-, sodium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
