CymitQuimica logo

CAS 87976-86-1

:

Cyclohexanone, 4-amino-

Description:
Cyclohexanone, 4-amino- is an organic compound characterized by a cyclohexanone ring with an amino group attached at the fourth position. It is a colorless to pale yellow liquid with a distinctive odor, similar to that of other ketones. This compound is soluble in water and organic solvents, making it versatile for various applications in organic synthesis and chemical manufacturing. The presence of the amino group introduces basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Cyclohexanone, 4-amino- can be used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation to the skin, eyes, and respiratory system. Overall, its unique structure and reactivity make it a valuable compound in chemical research and industrial applications.
Formula:C6H11NO
InChI:InChI=1S/C6H11NO/c7-5-1-3-6(8)4-2-5/h5H,1-4,7H2
InChI key:OTCYOBLTAQTFPW-UHFFFAOYSA-N
SMILES:C1CC(=O)CCC1N
Synonyms:
  • 4-Aminocyclohexanone
Found 2 products.