CAS 87977-26-2
:6-(4-Morpholinyl)-3-pyridazinecarbonitrile
Description:
6-(4-Morpholinyl)-3-pyridazinecarbonitrile, with the CAS number 87977-26-2, is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a morpholine group, a cyclic amine with a six-membered ring containing one oxygen and five carbon atoms, contributes to its unique properties, including potential solubility in polar solvents. This compound typically exhibits biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests it may interact with various biological targets, potentially influencing pharmacological effects. The carbonitrile functional group (-C≡N) adds to its reactivity and may participate in nucleophilic addition reactions. Overall, 6-(4-Morpholinyl)-3-pyridazinecarbonitrile is notable for its heterocyclic nature and potential applications in pharmaceuticals, although specific biological activities and applications would depend on further research and characterization.
Formula:C9H10N4O
InChI:InChI=1S/C9H10N4O/c10-7-8-1-2-9(12-11-8)13-3-5-14-6-4-13/h1-2H,3-6H2
InChI key:InChIKey=GHANKWUCKAVJJW-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=C(N=N1)N2CCOCC2
Synonyms:- 6-(4-Morpholinyl)-3-pyridazinecarbonitrile
- 3-Pyridazinecarbonitrile, 6-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
