
CAS 87977-27-3
:3-Pyridazinemethanamine, 6-(4-morpholinyl)-, hydrochloride (1:2)
Description:
3-Pyridazinemethanamine, 6-(4-morpholinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridazine and morpholine functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which is indicative of its polar nature. The presence of the hydrochloride salt form enhances its solubility and stability. This compound is often studied for its potential biological activities, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The morpholine moiety can contribute to its ability to interact with biological targets, making it a subject of interest in drug development. As with many amines, it may exhibit basicity, allowing it to form salts with acids. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Overall, 3-Pyridazinemethanamine, 6-(4-morpholinyl)-, hydrochloride (1:2) represents a class of compounds that may have significant implications in therapeutic applications.
Formula:C9H14N4O·2ClH
InChI:InChI=1S/C9H14N4O.2ClH/c10-7-8-1-2-9(12-11-8)13-3-5-14-6-4-13;;/h1-2H,3-7,10H2;2*1H
InChI key:InChIKey=JXRHCCMIHSFDBL-UHFFFAOYSA-N
SMILES:C(N)C1=CC=C(N=N1)N2CCOCC2.Cl
Synonyms:- 3-Pyridazinemethanamine, 6-(4-morpholinyl)-, hydrochloride (1:2)
- 3-Pyridazinemethanamine, 6-(4-morpholinyl)-, dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Pyridazinemethanamine, 6-(4-morpholinyl)-, hydrochloride (1:2)
CAS:Formula:C9H15ClN4OMolecular weight:230.6946
