CAS 87979-81-5
:ethyl (2E)-3-{4-[(1-methylprop-2-yn-1-yl)oxy]phenyl}but-2-enoate
Description:
Ethyl (2E)-3-{4-[(1-methylprop-2-yn-1-yl)oxy]phenyl}but-2-enoate, with the CAS number 87979-81-5, is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol and a carboxylic acid. This compound features a but-2-enoate backbone, indicating the presence of a double bond in the butenoate structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of a phenyl group substituted with an ether functionality (the 1-methylprop-2-yn-1-yl group) suggests that it may exhibit unique electronic properties and steric effects, influencing its behavior in chemical reactions. Ethyl (2E)-3-{4-[(1-methylprop-2-yn-1-yl)oxy]phenyl}but-2-enoate may be of interest in fields such as medicinal chemistry, materials science, or agrochemicals due to its potential biological activity and structural complexity. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in its handling and application.
Formula:C16H18O3
InChI:InChI=1/C16H18O3/c1-5-13(4)19-15-9-7-14(8-10-15)12(3)11-16(17)18-6-2/h1,7-11,13H,6H2,2-4H3/b12-11+
Synonyms:- 2-Butenoic acid, 3-(4-((1-methyl-2-propynyl)oxy)phenyl)-, ethyl ester, (E)-
- Ro 03-6037
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ro 03-6037
CAS:Ro 03-6037 is a bio-active chemical.Formula:C16H18O3Color and Shape:SolidMolecular weight:258.31
