CymitQuimica logo

CAS 879856-94-7

:

2-[(3-hydroxyphenyl)amino]-6-methylpyrimidin-4(1H)-one

Description:
2-[(3-hydroxyphenyl)amino]-6-methylpyrimidin-4(1H)-one, with the CAS number 879856-94-7, is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a hydroxyl group (-OH) attached to a phenyl ring, which is further substituted by an amino group (-NH2) at the para position relative to the hydroxyl. The presence of a methyl group (-CH3) at the 6-position of the pyrimidine ring contributes to its structural diversity. This compound may exhibit biological activity, potentially acting as a pharmaceutical agent or a biochemical probe, due to the presence of functional groups that can participate in hydrogen bonding and other interactions. Its solubility, stability, and reactivity can vary based on the pH and solvent conditions, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific properties and potential applications.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c1-7-5-10(16)14-11(12-7)13-8-3-2-4-9(15)6-8/h2-6,15H,1H3,(H2,12,13,14,16)
SMILES:Cc1cc(nc(n1)Nc1cccc(c1)O)O
Synonyms:
  • 2-[(3-Hydroxyphenyl)amino]-6-methylpyrimidin-4(3H)-one
  • 4(3H)-pyrimidinone, 2-[(3-hydroxyphenyl)amino]-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.