CAS 879883-64-4

1,1-Dimethylethyl 4-[(1-methyl-4-piperidinyl)methyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 4-[(1-methyl-4-piperidinyl)methyl]-1-piperidinecarboxylate, identified by its CAS number 879883-64-4, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is characterized by the presence of a dimethyl group and a carboxylate functional group. The compound exhibits potential pharmacological properties, often explored in medicinal chemistry for its interactions with biological targets. Its structure suggests it may possess lipophilic characteristics, which can influence its solubility and permeability in biological systems. Additionally, the presence of the piperidinyl moiety may contribute to its biological activity, making it a candidate for further research in drug development. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other chemical entities. Safety data and handling precautions should be consulted when working with this compound in a laboratory setting.

Formula: C₁₇H₃₂N₂O₂

InChI: InChI=1S/C17H32N2O2/c1-17(2,3)21-16(20)19-11-7-15(8-12-19)13-14-5-9-18(4)10-6-14/h14-15H,5-13H2,1-4H3

InChI key: InChIKey=HWWVEKRSGKSGFP-UHFFFAOYSA-N

SMILES: C(C1CCN(C(OC(C)(C)C)=O)CC1)C2CCN(C)CC2

Synonyms:

• 1-Piperidinecarboxylic acid, 4-[(1-methyl-4-piperidinyl)methyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[(1-methyl-4-piperidinyl)methyl]-1-piperidinecarboxylate