CAS 879896-47-6

(1-methyl-5-thiophen-2-yl-1H-pyrazol-3-yl)methanol

Description:

(1-methyl-5-thiophen-2-yl-1H-pyrazol-3-yl)methanol is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a methyl group and a thiophene moiety. This compound features a hydroxymethyl group (-CH2OH) attached to the pyrazole, which can influence its reactivity and solubility. The presence of the thiophene ring contributes to its potential electronic properties and may enhance its interactions in biological systems. Typically, compounds of this nature may exhibit interesting pharmacological activities, making them of interest in medicinal chemistry. The molecular structure suggests potential for hydrogen bonding due to the hydroxymethyl group, which can affect its solubility in polar solvents. Additionally, the presence of heteroatoms like sulfur in the thiophene ring can impart unique characteristics, such as increased stability and specific reactivity patterns. Overall, this compound's structural features suggest it may have applications in various fields, including pharmaceuticals and materials science.

Formula: C₉H₁₀N₂OS

InChI: InChI=1/C9H10N2OS/c1-11-8(5-7(6-12)10-11)9-3-2-4-13-9/h2-5,12H,6H2,1H3

SMILES: Cn1c(cc(CO)n1)c1cccs1

Synonyms:

• (1-methyl-5-thien-2-yl-1H-pyrazol-3-yl)methanol

(1-Methyl-5-thien-2-yl-1H-pyrazol-3-yl)methanol

CAS: 879896-47-6

(1-Methyl-5-thien-2-yl-1H-pyrazol-3-yl)methanol

Purity: 97%

Molecular weight: 194.25g/mol

Ref: 54-OR9308