CAS 879896-53-4

Ethanone, 2-bromo-1-[4-(3-thienyl)phenyl]-

Description:

Ethanone, 2-bromo-1-[4-(3-thienyl)phenyl]- is an organic compound characterized by its unique structure, which includes a bromine atom and a thienyl group attached to a phenyl ring. This compound features a ketone functional group, indicated by the ethanone designation, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The thienyl group, derived from thiophene, introduces heteroatoms into the structure, which can influence the compound's electronic properties and solubility. This compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. Overall, the characteristics of this compound suggest it may have applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity.

Formula: C₁₂H₉BrOS

InChI: InChI=1S/C12H9BrOS/c13-7-12(14)10-3-1-9(2-4-10)11-5-6-15-8-11/h1-6,8H,7H2

InChI key: InChIKey=ZTZQYKSMNMDCKR-UHFFFAOYSA-N

SMILES: C(CBr)(=O)C1=CC=C(C=C1)C=2C=CSC2

Synonyms:

• Ethanone, 2-bromo-1-[4-(3-thienyl)phenyl]-
• 2-Bromo-1-(4-thien-3-ylphenyl)ethanone
• 2-Bromo-1-[4-(thiophen-3-yl)phenyl]ethan-1-one

4-(Thien-3-yl)phenacyl bromide 95%

CAS: 879896-53-4

4-(Thien-3-yl)phenacyl bromide 95%

Purity: 95%

Ref: 54-OR9641