CAS 879896-55-6

2-(3-Methyl-1,2,4-oxadiazol-5-yl)benzenemethanol

Description:

2-(3-Methyl-1,2,4-oxadiazol-5-yl)benzenemethanol, identified by its CAS number 879896-55-6, is an organic compound characterized by the presence of a benzenemethanol moiety substituted with a 3-methyl-1,2,4-oxadiazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic structures, which may influence its solubility, reactivity, and biological activity. The oxadiazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological properties. The hydroxyl group in the benzenemethanol structure can participate in hydrogen bonding, enhancing its solubility in polar solvents and potentially affecting its interaction with biological targets. Additionally, the presence of the methyl group on the oxadiazole ring may influence the compound's electronic properties and steric hindrance, which can be critical for its reactivity and interaction with other molecules. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and materials science, warranting further investigation into its properties and uses.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-7-11-10(14-12-7)9-5-3-2-4-8(9)6-13/h2-5,13H,6H2,1H3

InChI key: InChIKey=BYRLVHLJWIKABJ-UHFFFAOYSA-N

SMILES: C(O)C1=C(C=CC=C1)C2=NC(C)=NO2

Synonyms:

• Benzenemethanol, 2-(3-methyl-1,2,4-oxadiazol-5-yl)-
• 2-(3-Methyl-1,2,4-oxadiazol-5-yl)benzenemethanol