CAS 879896-56-7

N-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanamine

Description:

N-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]methanamine is a chemical compound characterized by its unique structure, which includes a methyl group attached to a nitrogen atom and a phenyl ring substituted with a 3-methyl-1,2,4-oxadiazole moiety. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the oxadiazole ring may impart additional characteristics, such as potential biological activity or stability under certain conditions. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. Its specific interactions, such as binding affinity to biological targets, would depend on further empirical studies. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally.

Formula: C₁₁H₁₃N₃O

InChI: InChI=1/C11H13N3O/c1-8-13-11(15-14-8)10-6-4-3-5-9(10)7-12-2/h3-6,12H,7H2,1-2H3

SMILES: Cc1nc(c2ccccc2CNC)on1

N-Methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzylamine

CAS: 879896-56-7

N-Methyl-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzylamine

Purity: 97%

Molecular weight: 203.24g/mol

Ref: 54-OR12286