CAS 879896-62-5

N-methyl-1-(5-morpholin-4-ylthiophen-2-yl)methanamine

Description:

N-methyl-1-(5-morpholin-4-ylthiophen-2-yl)methanamine is a chemical compound characterized by its unique structure, which includes a thiophene ring substituted with a morpholine group and a methylated amine. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as moderate solubility in polar solvents and potential basicity due to the presence of the amine functional group. The morpholine moiety contributes to its potential biological activity, as morpholines are often found in pharmaceuticals and can influence the compound's interaction with biological targets. Additionally, the thiophene ring may impart electronic properties that enhance its reactivity or stability. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its behavior in various environments, including stability under different pH conditions and reactivity with other chemical species, would be essential for understanding its practical applications.

Formula: C₁₀H₁₆N₂OS

InChI: InChI=1/C10H16N2OS/c1-11-8-9-2-3-10(14-9)12-4-6-13-7-5-12/h2-3,11H,4-8H2,1H3

SMILES: CNCc1ccc(N2CCOCC2)s1

Synonyms:

• N-methyl-N-[(5-morpholin-4-ylthien-2-yl)methyl]amine