CAS 879896-63-6

7-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid

Description:

7-Bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thieno and dioxine moiety. The presence of a bromine atom at the 7-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and may facilitate interactions with biological systems. The dihydrothieno structure suggests that it may exhibit interesting electronic properties, potentially making it useful in materials science or as a precursor in the synthesis of more complex molecules. Additionally, the compound's structural features may impart specific biological activities, warranting investigation for pharmaceutical applications. Overall, 7-bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylic acid represents a versatile scaffold for further chemical exploration and development.

Formula: C₇H₅BrO₄S

InChI: InChI=1/C7H5BrO4S/c8-6-4-3(11-1-2-12-4)5(13-6)7(9)10/h1-2H2,(H,9,10)

SMILES: C1COc2c(c(C(=O)O)sc2Br)O1

Thieno[3,4-b]-1,4-dioxin-5-carboxylicacid, 7-bromo-2,3-dihydro-

CAS: 879896-63-6

Formula: C₇H₅BrO₄S

Purity: 95%

Molecular weight: 265.0812

Ref: IN-DA008EBE