CAS 879896-64-7

3-(2-Oxo-1,2-diphenylethoxy)propanoic acid

Description:

3-(2-Oxo-1,2-diphenylethoxy)propanoic acid, identified by its CAS number 879896-64-7, is an organic compound characterized by its unique structure that includes a propanoic acid moiety linked to a diphenylethoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which may influence its solubility, reactivity, and potential biological activity. The presence of the ketone functional group (2-oxo) suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the diphenyl groups can enhance the compound's stability and may contribute to its hydrophobic characteristics. As a result, this compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific characteristics, such as melting point, boiling point, and spectral properties, would need to be determined through experimental methods or detailed literature review for precise applications and behavior in different environments.

Formula: C₁₇H₁₆O₄

InChI: InChI=1S/C17H16O4/c18-15(19)11-12-21-17(14-9-5-2-6-10-14)16(20)13-7-3-1-4-8-13/h1-10,17H,11-12H2,(H,18,19)

InChI key: InChIKey=GLPKRJMUMJUFOC-UHFFFAOYSA-N

SMILES: C(C(=O)C1=CC=CC=C1)(OCCC(O)=O)C2=CC=CC=C2

Synonyms:

• Propanoic acid, 3-(2-oxo-1,2-diphenylethoxy)-
• 3-(2-Oxo-1,2-diphenylethoxy)propanoic acid