CAS 879904-88-8

Silanol, 1-(2-furanyl)-1,1-dimethyl-, sodium salt (1:1)

Description:

Silanol, 1-(2-furanyl)-1,1-dimethyl-, sodium salt (1:1) is a chemical compound characterized by its silanol functional group, which features a silicon atom bonded to hydroxyl groups. The presence of the 2-furanyl group indicates that the compound has a furan ring, contributing to its aromatic properties and potential reactivity. As a sodium salt, it is likely to exhibit increased solubility in polar solvents, such as water, due to the ionic nature of the sodium ion. This compound may be utilized in various applications, including organic synthesis and materials science, owing to its unique structural features that can facilitate chemical reactions or interactions with other substances. The presence of both silanol and aromatic components suggests potential uses in catalysis or as intermediates in the synthesis of more complex molecules. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Safety data and handling precautions should also be considered when working with this compound.

Formula: C₆H₁₀O₂Si·Na

InChI: InChI=1S/C6H10O2Si.Na/c1-9(2,7)6-4-3-5-8-6;/h3-5,7H,1-2H3;

InChI key: InChIKey=WHZZRZHZQWMTNF-UHFFFAOYSA-N

SMILES: [Si](C)(C)(O)C1=CC=CO1.[Na]

Synonyms:

• Silanol, 1-(2-furanyl)-1,1-dimethyl-, sodium salt (1:1)
• Silanol, 2-furanyldimethyl-, sodium salt