CAS 87994-64-7
:4,4-Bis[2-(2-methoxyethoxy)ethoxy]-5,8,11-trioxa-4-siladodecan-1-amine
Description:
4,4-Bis[2-(2-methoxyethoxy)ethoxy]-5,8,11-trioxa-4-siladodecan-1-amine, with CAS number 87994-64-7, is a siloxane compound characterized by its unique structure that incorporates both siloxane and ether functionalities. This compound features a silane backbone, which contributes to its potential applications in materials science, particularly in the development of silane-based coatings and adhesives. The presence of multiple ether groups enhances its solubility in organic solvents and may improve its compatibility with various substrates. Additionally, the amine functional group can facilitate interactions with other chemical species, making it useful in formulations requiring adhesion or surface modification. The compound's molecular structure suggests it may exhibit properties such as thermal stability and flexibility, which are advantageous in various industrial applications. Overall, 4,4-Bis[2-(2-methoxyethoxy)ethoxy]-5,8,11-trioxa-4-siladodecan-1-amine is a versatile chemical with potential uses in coatings, sealants, and other polymeric materials.
Formula:C18H41NO9Si
InChI:InChI=1S/C18H41NO9Si/c1-20-6-9-23-12-15-26-29(18-4-5-19,27-16-13-24-10-7-21-2)28-17-14-25-11-8-22-3/h4-19H2,1-3H3
InChI key:InChIKey=PJURIXUDYDHOMA-UHFFFAOYSA-N
SMILES:[Si](OCCOCCOC)(OCCOCCOC)(OCCOCCOC)CCCN
Synonyms:- 2,5,8-Trioxa-9-siladodecan-12-amine, 9,9-bis[2-(2-methoxyethoxy)ethoxy]-
- 3-Aminopropyltris(3,6-dioxaheptyloxy)silane
- 3-Aminopropyltris(methoxyethoxyethoxy)silane
- 3-[Tris[2-(2-methoxyethoxy)ethoxy]silyl]propylamine
- 4,4-Bis[2-(2-methoxyethoxy)ethoxy]-5,8,11-trioxa-4-siladodecan-1-amine
- 5,8,11-Trioxa-4-siladodecan-1-amine, 4,4-bis[2-(2-methoxyethoxy)ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.