CAS 87996-55-2
:(4-Chlorophenyl)[4-(trifluoromethoxy)phenyl]methanone
Description:
(4-Chlorophenyl)[4-(trifluoromethoxy)phenyl]methanone, with the CAS number 87996-55-2, is an organic compound characterized by its complex structure, which includes a chlorophenyl group and a trifluoromethoxy group attached to a central carbonyl moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points due to the presence of multiple aromatic rings. The trifluoromethoxy group contributes to its unique reactivity and polarity, potentially enhancing its solubility in polar solvents. Additionally, the presence of chlorine and trifluoromethyl groups can influence its electronic properties, making it a candidate for various applications in pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, which is often a focus in medicinal chemistry. Overall, its structural features suggest potential utility in synthetic chemistry and material science, although specific applications would depend on further research into its reactivity and interactions with biological systems.
Formula:C14H8ClF3O2
InChI:InChI=1S/C14H8ClF3O2/c15-11-5-1-9(2-6-11)13(19)10-3-7-12(8-4-10)20-14(16,17)18/h1-8H
InChI key:InChIKey=HKXKIYARIGTDNN-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OC(F)(F)F)C=C1)C2=CC=C(Cl)C=C2
Synonyms:- (4-Chlorophenyl)[4-(Trifluoromethoxy)Phenyl]Methanone
- 4'-Chloro-4-trifluoromethoxybenzophenone
- Methanone, (4-chlorophenyl)[4-(trifluoromethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(4-Chloro-phenyl)-(4-trifluoromethoxy-phenyl)-methanone
CAS:Formula:C14H8ClF3O2Molecular weight:300.6603
