CAS 879996-62-0

3-(2-Fluorophenyl)-1H-pyrazole-4-carboxaldehyde

Description:

3-(2-Fluorophenyl)-1H-pyrazole-4-carboxaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its reactivity. The aldehyde functional group (-CHO) at the 4-position of the pyrazole ring is significant for its reactivity, allowing for various chemical transformations, including condensation reactions and nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and conditions, and it may be sensitive to light or moisture. The compound's molecular structure and functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment.

Formula: C₁₀H₇FN₂O

InChI: InChI=1S/C10H7FN2O/c11-9-4-2-1-3-8(9)10-7(6-14)5-12-13-10/h1-6H,(H,12,13)

InChI key: InChIKey=BENGWFNHUIVIBV-UHFFFAOYSA-N

SMILES: C(=O)C=1C(=NNC1)C2=C(F)C=CC=C2

Synonyms:

• 3-(2-Fluorophenyl)-1H-pyrazole-4-carboxaldehyde
• 1H-Pyrazole-4-carboxaldehyde, 3-(2-fluorophenyl)-

3-(2-Fluorophenyl)-1H-pyrazole-4-carbaldehyde

CAS: 879996-62-0

Versatile small molecule scaffold

Formula: C₁₀H₇FN₂O

Purity: Min. 95%

Molecular weight: 190.17 g/mol

Ref: 3D-EKB99662